C24H22F2N4O5 — CID 11605467
4-[[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoyl]anilino]methyl]-N-(2-methoxyethyl)pyridine-2-carboxamide (PubChem CID 11605467) has the molecular formula C24H22F2N4O5 and a molecular weight of 484.46 g/mol. Its IUPAC name is 4-[[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoyl]anilino]methyl]-N-(2-methoxyethyl)pyridine-2-carboxamide.
| Compound Name | 4-[[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoyl]anilino]methyl]-N-(2-methoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11605467 |
| Molecular Formula | C24H22F2N4O5 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 4-[[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoyl]anilino]methyl]-N-(2-methoxyethyl)pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cc(CNc2ccccc2C(=O)Nc2ccc3c(c2)OC(F)(F)O3)ccn1 |
| InChI | InChI=1S/C24H22F2N4O5/c1-33-11-10-28-23(32)19-12-15(8-9-27-19)14-29-18-5-3-2-4-17(18)22(31)30-16-6-7-20-21(13-16)35-24(25,26)34-20/h2-9,12-13,29H,10-11,14H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | WZERXMDVFBGCAP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|