About 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one
1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one (PubChem CID 11605702) has the molecular formula C23H16F6N2O2S
and a molecular weight of 498.45 g/mol. Its IUPAC name is 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one |
| PubChem CID | 11605702 |
| Molecular Formula | C23H16F6N2O2S |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one |
| SMILES | O=C1CCN(c2sc(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2-c2ccncc2)CC1 |
| InChI | InChI=1S/C23H16F6N2O2S/c24-22(25,26)15-9-14(10-16(11-15)23(27,28)29)20(33)19-12-18(13-1-5-30-6-2-13)21(34-19)31-7-3-17(32)4-8-31/h1-2,5-6,9-12H,3-4,7-8H2 |
| InChIKey | YWKFRWZWBIZFQL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one?
The IUPAC name of 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one (CID 11605702) is 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one.
What is the SMILES notation for 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one?
The canonical SMILES for 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one is O=C1CCN(c2sc(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2-c2ccncc2)CC1.
What is the InChIKey of 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one?
The InChIKey is YWKFRWZWBIZFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16F6N2O2S/c24-22(25,26)15-9-14(10-16(11-15)23(27,28)29)20(33)19-12-18(13-1-5-30-6-2-13)21(34-19)31-7-3-17(32)4-8-31/h1-2,5-6,9-12H,3-4,7-8H2.
What are the key properties of 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one?
1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one has a molecular weight of 498.45 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[3,5-bis(trifluoromethyl)benzoyl]-3-pyridin-4-ylthiophen-2-yl]piperidin-4-one is sourced from PubChem (CID 11605702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).