C34H34NOP — CID 11605813
diphenyl-[11-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane (PubChem CID 11605813) has the molecular formula C34H34NOP and a molecular weight of 503.63 g/mol. Its IUPAC name is diphenyl-[11-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane.
| Compound Name | diphenyl-[11-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane |
|---|---|
| PubChem CID | 11605813 |
| Molecular Formula | C34H34NOP |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | diphenyl-[11-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane |
| SMILES | CC(C)[C@H]1COC(c2cc3ccc2CCc2ccc(c(P(c4ccccc4)c4ccccc4)c2)CC3)=N1 |
| InChI | InChI=1S/C34H34NOP/c1-24(2)32-23-36-34(35-32)31-21-25-13-17-27(31)18-14-26-16-20-28(19-15-25)33(22-26)37(29-9-5-3-6-10-29)30-11-7-4-8-12-30/h3-13,16-17,20-22,24,32H,14-15,18-19,23H2,1-2H3/t32-/m1/s1 |
| InChIKey | AXCUTWQIHKTXNZ-JGCGQSQUSA-N |
| XLogP | 6.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|