About O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate
O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate (PubChem CID 11605898) has the molecular formula C21H42O2S2Sn
and a molecular weight of 509.41 g/mol. Its IUPAC name is O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate |
| PubChem CID | 11605898 |
| Molecular Formula | C21H42O2S2Sn |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(CCC(C)(C)C=O)OC(=S)SC |
| InChI | InChI=1S/C9H15O2S2.3C4H9.Sn/c1-9(2,7-10)5-4-6-11-8(12)13-3;3*1-3-4-2;/h6-7H,4-5H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | RRTQQYWQTGEVEL-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate?
The IUPAC name of O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate (CID 11605898) is O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate.
What is the SMILES notation for O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate?
The canonical SMILES for O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate is CCCC[Sn](CCCC)(CCCC)C(CCC(C)(C)C=O)OC(=S)SC.
What is the InChIKey of O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate?
The InChIKey is RRTQQYWQTGEVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O2S2.3C4H9.Sn/c1-9(2,7-10)5-4-6-11-8(12)13-3;3*1-3-4-2;/h6-7H,4-5H2,1-3H3;3*1,3-4H2,2H3;.
What are the key properties of O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate?
O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate has a molecular weight of 509.41 g/mol, XLogP of 7.41, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4,4-dimethyl-5-oxo-1-tributylstannylpentyl) methylsulfanylmethanethioate is sourced from PubChem (CID 11605898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).