About tricyclohexylstannyl pyrrolidine-1-carbodithioate
tricyclohexylstannyl pyrrolidine-1-carbodithioate (PubChem CID 11605972) has the molecular formula C23H41NS2Sn
and a molecular weight of 514.43 g/mol. Its IUPAC name is tricyclohexylstannyl pyrrolidine-1-carbodithioate.
Molecular Properties
| Compound Name | tricyclohexylstannyl pyrrolidine-1-carbodithioate |
| PubChem CID | 11605972 |
| Molecular Formula | C23H41NS2Sn |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | tricyclohexylstannyl pyrrolidine-1-carbodithioate |
| SMILES | S=C(S[Sn](C1CCCCC1)(C1CCCCC1)C1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/3C6H11.C5H9NS2.Sn/c3*1-2-4-6-5-3-1;7-5(8)6-3-1-2-4-6;/h3*1H,2-6H2;1-4H2,(H,7,8);/q;;;;+1/p-1 |
| InChIKey | MCVXJUINXLGBGJ-UHFFFAOYSA-M |
| XLogP | 8.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tricyclohexylstannyl pyrrolidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexylstannyl pyrrolidine-1-carbodithioate?
The IUPAC name of tricyclohexylstannyl pyrrolidine-1-carbodithioate (CID 11605972) is tricyclohexylstannyl pyrrolidine-1-carbodithioate.
What is the SMILES notation for tricyclohexylstannyl pyrrolidine-1-carbodithioate?
The canonical SMILES for tricyclohexylstannyl pyrrolidine-1-carbodithioate is S=C(S[Sn](C1CCCCC1)(C1CCCCC1)C1CCCCC1)N1CCCC1.
What is the InChIKey of tricyclohexylstannyl pyrrolidine-1-carbodithioate?
The InChIKey is MCVXJUINXLGBGJ-UHFFFAOYSA-M. The full InChI is InChI=1S/3C6H11.C5H9NS2.Sn/c3*1-2-4-6-5-3-1;7-5(8)6-3-1-2-4-6;/h3*1H,2-6H2;1-4H2,(H,7,8);/q;;;;+1/p-1.
What are the key properties of tricyclohexylstannyl pyrrolidine-1-carbodithioate?
tricyclohexylstannyl pyrrolidine-1-carbodithioate has a molecular weight of 514.43 g/mol, XLogP of 8.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexylstannyl pyrrolidine-1-carbodithioate is sourced from PubChem (CID 11605972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).