C29H32FN5O4 — CID 11606236
1-[3-tert-butyl-1-[3-(3-hydroxypropoxy)phenyl]pyrazol-5-yl]-3-[2-fluoro-4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea (PubChem CID 11606236) has the molecular formula C29H32FN5O4 and a molecular weight of 533.60 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-[3-(3-hydroxypropoxy)phenyl]pyrazol-5-yl]-3-[2-fluoro-4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea.
| Compound Name | 1-[3-tert-butyl-1-[3-(3-hydroxypropoxy)phenyl]pyrazol-5-yl]-3-[2-fluoro-4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea |
|---|---|
| PubChem CID | 11606236 |
| Molecular Formula | C29H32FN5O4 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 1-[3-tert-butyl-1-[3-(3-hydroxypropoxy)phenyl]pyrazol-5-yl]-3-[2-fluoro-4-[(2-methyl-4-pyridinyl)oxy]phenyl]urea |
| SMILES | Cc1cc(Oc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3cccc(OCCCO)c3)c(F)c2)ccn1 |
| InChI | InChI=1S/C29H32FN5O4/c1-19-15-23(11-12-31-19)39-22-9-10-25(24(30)17-22)32-28(37)33-27-18-26(29(2,3)4)34-35(27)20-7-5-8-21(16-20)38-14-6-13-36/h5,7-12,15-18,36H,6,13-14H2,1-4H3,(H2,32,33,37) |
| InChIKey | WYIXXQVVUPYOHS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|