About [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane
[7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane (PubChem CID 11606289) has the molecular formula C39H42Si
and a molecular weight of 538.85 g/mol. Its IUPAC name is [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane |
| PubChem CID | 11606289 |
| Molecular Formula | C39H42Si |
| Molecular Weight | 538.85 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane |
| SMILES | CCCCc1ccc(-c2cc([Si](C)(C)C)c(-c3ccc(CCCC)cc3)c3c2-c2cccc4cccc-3c24)cc1 |
| InChI | InChI=1S/C39H42Si/c1-6-8-12-27-18-22-29(23-19-27)34-26-35(40(3,4)5)37(31-24-20-28(21-25-31)13-9-7-2)39-33-17-11-15-30-14-10-16-32(36(30)33)38(34)39/h10-11,14-26H,6-9,12-13H2,1-5H3 |
| InChIKey | FUYLZFFKTWLUMA-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.85 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane?
The IUPAC name of [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane (CID 11606289) is [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane.
What is the SMILES notation for [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane?
The canonical SMILES for [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane is CCCCc1ccc(-c2cc([Si](C)(C)C)c(-c3ccc(CCCC)cc3)c3c2-c2cccc4cccc-3c24)cc1.
What is the InChIKey of [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane?
The InChIKey is FUYLZFFKTWLUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H42Si/c1-6-8-12-27-18-22-29(23-19-27)34-26-35(40(3,4)5)37(31-24-20-28(21-25-31)13-9-7-2)39-33-17-11-15-30-14-10-16-32(36(30)33)38(34)39/h10-11,14-26H,6-9,12-13H2,1-5H3.
What are the key properties of [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane?
[7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane has a molecular weight of 538.85 g/mol, XLogP of 11.05, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [7,10-bis(4-butylphenyl)fluoranthen-8-yl]-trimethylsilane is sourced from PubChem (CID 11606289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).