C26H21F4N7O2 — CID 11606292
6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 11606292) has the molecular formula C26H21F4N7O2 and a molecular weight of 539.49 g/mol. Its IUPAC name is 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 11606292 |
| Molecular Formula | C26H21F4N7O2 |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5n[nH]c(C(F)(F)F)n5)ccc43)ncn2)ccc1F |
| InChI | InChI=1S/C26H21F4N7O2/c1-13-8-14(2-6-18(13)27)11-31-23(38)20-10-21(33-12-32-20)24(39)34-19-7-4-15-9-16(3-5-17(15)19)22-35-25(37-36-22)26(28,29)30/h2-3,5-6,8-10,12,19H,4,7,11H2,1H3,(H,31,38)(H,34,39)(H,35,36,37)/t19-/m0/s1 |
| InChIKey | FIUJPDHFZXOHMM-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |