C25H28ClF3O6Si — CID 11606350
[(3S,3aR,6R,6aR)-3-[(4-chlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate (PubChem CID 11606350) has the molecular formula C25H28ClF3O6Si and a molecular weight of 545.03 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-[(4-chlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate.
| Compound Name | [(3S,3aR,6R,6aR)-3-[(4-chlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 11606350 |
| Molecular Formula | C25H28ClF3O6Si |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-[(4-chlorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate |
| SMILES | C[Si](C)(C)O[C@](C(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OCc1ccc(Cl)cc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H28ClF3O6Si/c1-36(2,3)35-24(25(27,28)29,17-7-5-4-6-8-17)23(30)34-20-15-33-21-19(14-32-22(20)21)31-13-16-9-11-18(26)12-10-16/h4-12,19-22H,13-15H2,1-3H3/t19-,20+,21+,22+,24-/m0/s1 |
| InChIKey | GPUWLUZUQALTTN-PIIZRUITSA-N |
| XLogP | 5.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|