C29H54O6P2 — CID 11606513
(6E,10E)-13,13-bis(diethoxyphosphoryl)-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene (PubChem CID 11606513) has the molecular formula C29H54O6P2 and a molecular weight of 560.69 g/mol. Its IUPAC name is (6E,10E)-13,13-bis(diethoxyphosphoryl)-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene.
| Compound Name | (6E,10E)-13,13-bis(diethoxyphosphoryl)-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene |
|---|---|
| PubChem CID | 11606513 |
| Molecular Formula | C29H54O6P2 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | (6E,10E)-13,13-bis(diethoxyphosphoryl)-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene |
| SMILES | CCOP(=O)(OCC)C(CC=C(C)C)(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C29H54O6P2/c1-11-32-36(30,33-12-2)29(23-21-26(7)8,37(31,34-13-3)35-14-4)24-22-28(10)20-16-19-27(9)18-15-17-25(5)6/h17,19,21-22H,11-16,18,20,23-24H2,1-10H3/b27-19+,28-22+ |
| InChIKey | SPUHSTYLWGORMV-XQTTYNNVSA-N |
| XLogP | 10.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|