C30H39BrO6 — CID 11606645
3-[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]-3-hydroxy-2,2-dimethylpropanoic acid (PubChem CID 11606645) has the molecular formula C30H39BrO6 and a molecular weight of 575.54 g/mol. Its IUPAC name is 3-[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]-3-hydroxy-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]-3-hydroxy-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 11606645 |
| Molecular Formula | C30H39BrO6 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 3-[3-bromo-4-[[2,5,7,8-tetramethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromen-2-yl]methoxy]phenyl]-3-hydroxy-2,2-dimethylpropanoic acid |
| SMILES | CC(C)=CCOc1c(C)c(C)c2c(c1C)CCC(C)(COc1ccc(C(O)C(C)(C)C(=O)O)cc1Br)O2 |
| InChI | InChI=1S/C30H39BrO6/c1-17(2)12-14-35-25-18(3)19(4)26-22(20(25)5)11-13-30(8,37-26)16-36-24-10-9-21(15-23(24)31)27(32)29(6,7)28(33)34/h9-10,12,15,27,32H,11,13-14,16H2,1-8H3,(H,33,34) |
| InChIKey | DFXDUPVYGZOUSR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|