C28H34Cl2N4O4S — CID 11606800
[4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3,3-dimethylbutane-1-sulfonate (PubChem CID 11606800) has the molecular formula C28H34Cl2N4O4S and a molecular weight of 593.58 g/mol. Its IUPAC name is [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3,3-dimethylbutane-1-sulfonate.
| Compound Name | [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3,3-dimethylbutane-1-sulfonate |
|---|---|
| PubChem CID | 11606800 |
| Molecular Formula | C28H34Cl2N4O4S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3,3-dimethylbutane-1-sulfonate |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(OS(=O)(=O)CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H34Cl2N4O4S/c1-19-25(27(35)32-33-15-6-5-7-16-33)31-26(23-13-8-20(29)18-24(23)30)34(19)21-9-11-22(12-10-21)38-39(36,37)17-14-28(2,3)4/h8-13,18H,5-7,14-17H2,1-4H3,(H,32,35) |
| InChIKey | ZNMIQISEBPJMOW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|