C35H32N4O2Zn — CID 11606861
zinc (1Z)-1-[12-acetyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate (PubChem CID 11606861) has the molecular formula C35H32N4O2Zn and a molecular weight of 606.06 g/mol. Its IUPAC name is zinc (1Z)-1-[12-acetyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate.
| Compound Name | zinc (1Z)-1-[12-acetyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate |
|---|---|
| PubChem CID | 11606861 |
| Molecular Formula | C35H32N4O2Zn |
| Molecular Weight | 606.06 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | zinc (1Z)-1-[12-acetyl-17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18H-porphyrin-21-id-2-ylidene]ethanolate |
| SMILES | CC(=O)C1=CC2=N/C1=C\C1=N/C(=C(/c3c(C)cc(C)cc3C)c3cc(=C(\C)[O-])/c([n-]3)=C/C3=N/C(=C\2)C(C)(C)C3)C=C1.[Zn+2] |
| InChI | InChI=1S/C35H34N4O2.Zn/c1-18-10-19(2)33(20(3)11-18)34-28-9-8-23(36-28)13-29-26(21(4)40)12-24(37-29)15-32-35(6,7)17-25(38-32)14-30-27(22(5)41)16-31(34)39-30;/h8-16H,17H2,1-7H3,(H2,36,37,38,39,40,41);/q;+2/p-2 |
| InChIKey | ONENOKIWSWCGEZ-UHFFFAOYSA-L |
| XLogP | 4.23 |
| TPSA | 91.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.06 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|