C34H52N4O4S — CID 11606910
(2S)-N-(2-methylpropyl)-2-[[(4S)-17-[methylsulfonyl(propyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]hexanamide (PubChem CID 11606910) has the molecular formula C34H52N4O4S and a molecular weight of 612.88 g/mol. Its IUPAC name is (2S)-N-(2-methylpropyl)-2-[[(4S)-17-[methylsulfonyl(propyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]hexanamide.
| Compound Name | (2S)-N-(2-methylpropyl)-2-[[(4S)-17-[methylsulfonyl(propyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]hexanamide |
|---|---|
| PubChem CID | 11606910 |
| Molecular Formula | C34H52N4O4S |
| Molecular Weight | 612.88 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | (2S)-N-(2-methylpropyl)-2-[[(4S)-17-[methylsulfonyl(propyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]hexanamide |
| SMILES | CCCC[C@H](NC[C@@H]1Cc2cccc(c2)CCCCc2cc(cc(N(CCC)S(C)(=O)=O)c2)C(=O)N1)C(=O)NCC(C)C |
| InChI | InChI=1S/C34H52N4O4S/c1-6-8-16-32(34(40)36-23-25(3)4)35-24-30-20-27-15-11-14-26(18-27)12-9-10-13-28-19-29(33(39)37-30)22-31(21-28)38(17-7-2)43(5,41)42/h11,14-15,18-19,21-22,25,30,32,35H,6-10,12-13,16-17,20,23-24H2,1-5H3,(H,36,40)(H,37,39)/t30-,32-/m0/s1 |
| InChIKey | JRTACURQOKVHSE-CDZUIXILSA-N |
| XLogP | 5.00 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.88 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |