C41H57FN4O — CID 11607034
N-[[4-fluoro-3-[3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]phenyl]methyl]-N-nonyl-3-(piperidin-4-ylmethyl)benzamide (PubChem CID 11607034) has the molecular formula C41H57FN4O and a molecular weight of 640.93 g/mol. Its IUPAC name is N-[[4-fluoro-3-[3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]phenyl]methyl]-N-nonyl-3-(piperidin-4-ylmethyl)benzamide.
| Compound Name | N-[[4-fluoro-3-[3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]phenyl]methyl]-N-nonyl-3-(piperidin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 11607034 |
| Molecular Formula | C41H57FN4O |
| Molecular Weight | 640.93 g/mol |
| Exact Mass | 640.45 |
| IUPAC Name | N-[[4-fluoro-3-[3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]phenyl]methyl]-N-nonyl-3-(piperidin-4-ylmethyl)benzamide |
| SMILES | CCCCCCCCCN(Cc1ccc(F)c(-c2cccc(CN3CCN[C@@H](C)C3)c2)c1)C(=O)c1cccc(CC2CCNCC2)c1 |
| InChI | InChI=1S/C41H57FN4O/c1-3-4-5-6-7-8-9-23-46(41(47)38-15-10-12-34(26-38)25-33-18-20-43-21-19-33)31-36-16-17-40(42)39(28-36)37-14-11-13-35(27-37)30-45-24-22-44-32(2)29-45/h10-17,26-28,32-33,43-44H,3-9,18-25,29-31H2,1-2H3/t32-/m0/s1 |
| InChIKey | NZUAYSDLGHHERG-YTTGMZPUSA-N |
| XLogP | 8.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.93 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|