C27H32F3N3O2 — CID 11607188
2'-[(dimethylamino)methyl]-6-methoxy-1'-[4-(trifluoromethyl)phenyl]spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol (PubChem CID 11607188) has the molecular formula C27H32F3N3O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 2'-[(dimethylamino)methyl]-6-methoxy-1'-[4-(trifluoromethyl)phenyl]spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol.
| Compound Name | 2'-[(dimethylamino)methyl]-6-methoxy-1'-[4-(trifluoromethyl)phenyl]spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol |
|---|---|
| PubChem CID | 11607188 |
| Molecular Formula | C27H32F3N3O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2'-[(dimethylamino)methyl]-6-methoxy-1'-[4-(trifluoromethyl)phenyl]spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC31CCC(O)(c2ccc(C(F)(F)F)cc2)C(CN(C)C)C1 |
| InChI | InChI=1S/C27H32F3N3O2/c1-33(2)16-19-15-25(11-12-26(19,34)17-4-6-18(7-5-17)27(28,29)30)24-21(10-13-31-25)22-14-20(35-3)8-9-23(22)32-24/h4-9,14,19,31-32,34H,10-13,15-16H2,1-3H3 |
| InChIKey | XKEDHIUGFGFAGD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |