C20H5ClI6O5 — CID 11607760
7-chloro-3',6'-dihydroxy-2',4,4',5,5',7'-hexaiodospiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 11607760) has the molecular formula C20H5ClI6O5 and a molecular weight of 1122.13 g/mol. Its IUPAC name is 7-chloro-3',6'-dihydroxy-2',4,4',5,5',7'-hexaiodospiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 7-chloro-3',6'-dihydroxy-2',4,4',5,5',7'-hexaiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 11607760 |
| Molecular Formula | C20H5ClI6O5 |
| Molecular Weight | 1122.13 g/mol |
| Exact Mass | 1121.41 |
| IUPAC Name | 7-chloro-3',6'-dihydroxy-2',4,4',5,5',7'-hexaiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3cc(I)c(O)c(I)c3Oc3c2cc(I)c(O)c3I)c2c(I)c(I)cc(Cl)c21 |
| InChI | InChI=1S/C20H5ClI6O5/c21-6-3-7(22)12(25)11-10(6)19(30)32-20(11)4-1-8(23)15(28)13(26)17(4)31-18-5(20)2-9(24)16(29)14(18)27/h1-3,28-29H |
| InChIKey | BLVOPGBQPNRLNK-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.13 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|