C7H6N2O2 — CID 11607937
1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 11607937) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | 1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 11607937 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | O=C1Nc2ncccc2CO1 |
| InChI | InChI=1S/C7H6N2O2/c10-7-9-6-5(4-11-7)2-1-3-8-6/h1-3H,4H2,(H,8,9,10) |
| InChIKey | FJGUVVCDYSUGPG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |