About 1-(1,2,4-triazol-1-yl)ethyl acetate
1-(1,2,4-triazol-1-yl)ethyl acetate (PubChem CID 11607950) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 1-(1,2,4-triazol-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 1-(1,2,4-triazol-1-yl)ethyl acetate |
| PubChem CID | 11607950 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 1-(1,2,4-triazol-1-yl)ethyl acetate |
| SMILES | CC(=O)OC(C)n1cncn1 |
| InChI | InChI=1S/C6H9N3O2/c1-5(11-6(2)10)9-4-7-3-8-9/h3-5H,1-2H3 |
| InChIKey | RWVAMJREFKTNFH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,2,4-triazol-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,4-triazol-1-yl)ethyl acetate?
The IUPAC name of 1-(1,2,4-triazol-1-yl)ethyl acetate (CID 11607950) is 1-(1,2,4-triazol-1-yl)ethyl acetate.
What is the SMILES notation for 1-(1,2,4-triazol-1-yl)ethyl acetate?
The canonical SMILES for 1-(1,2,4-triazol-1-yl)ethyl acetate is CC(=O)OC(C)n1cncn1.
What is the InChIKey of 1-(1,2,4-triazol-1-yl)ethyl acetate?
The InChIKey is RWVAMJREFKTNFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-5(11-6(2)10)9-4-7-3-8-9/h3-5H,1-2H3.
What are the key properties of 1-(1,2,4-triazol-1-yl)ethyl acetate?
1-(1,2,4-triazol-1-yl)ethyl acetate has a molecular weight of 155.16 g/mol, XLogP of 0.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,4-triazol-1-yl)ethyl acetate is sourced from PubChem (CID 11607950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).