C6H13NO4 — CID 11607966
(1R,2R,3R,4S,5S)-4-amino-5-methoxycyclopentane-1,2,3-triol (PubChem CID 11607966) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S)-4-amino-5-methoxycyclopentane-1,2,3-triol.
| Compound Name | (1R,2R,3R,4S,5S)-4-amino-5-methoxycyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 11607966 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (1R,2R,3R,4S,5S)-4-amino-5-methoxycyclopentane-1,2,3-triol |
| SMILES | CO[C@H]1[C@@H](N)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13NO4/c1-11-6-2(7)3(8)4(9)5(6)10/h2-6,8-10H,7H2,1H3/t2-,3+,4+,5+,6-/m0/s1 |
| InChIKey | NLCVJSNNNWJBCS-BSQWINAVSA-N |
| XLogP | -2.58 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |