C9H10O3 — CID 11607976
2-prop-1-en-2-yl-3,6-dihydro-2H-furo[2,3-c]furan-4-one (PubChem CID 11607976) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-3,6-dihydro-2H-furo[2,3-c]furan-4-one.
| Compound Name | 2-prop-1-en-2-yl-3,6-dihydro-2H-furo[2,3-c]furan-4-one |
|---|---|
| PubChem CID | 11607976 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-prop-1-en-2-yl-3,6-dihydro-2H-furo[2,3-c]furan-4-one |
| SMILES | C=C(C)C1CC2=C(COC2=O)O1 |
| InChI | InChI=1S/C9H10O3/c1-5(2)7-3-6-8(12-7)4-11-9(6)10/h7H,1,3-4H2,2H3 |
| InChIKey | QPUZSQJRNOKXHB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|