About 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one
6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 11608093) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| PubChem CID | 11608093 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | O=C1CSc2ccc(CO)nc2N1 |
| InChI | InChI=1S/C8H8N2O2S/c11-3-5-1-2-6-8(9-5)10-7(12)4-13-6/h1-2,11H,3-4H2,(H,9,10,12) |
| InChIKey | QKCZJBYIJRYYFB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one?
The IUPAC name of 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one (CID 11608093) is 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one.
What is the SMILES notation for 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one?
The canonical SMILES for 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one is O=C1CSc2ccc(CO)nc2N1.
What is the InChIKey of 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one?
The InChIKey is QKCZJBYIJRYYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c11-3-5-1-2-6-8(9-5)10-7(12)4-13-6/h1-2,11H,3-4H2,(H,9,10,12).
What are the key properties of 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one?
6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one has a molecular weight of 196.23 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-4H-pyrido[3,2-b][1,4]thiazin-3-one is sourced from PubChem (CID 11608093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).