C13H15N3 — CID 11608193
5-methyl-2-(2-phenylethyl)pyrimidin-4-amine (PubChem CID 11608193) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-methyl-2-(2-phenylethyl)pyrimidin-4-amine.
| Compound Name | 5-methyl-2-(2-phenylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 11608193 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-methyl-2-(2-phenylethyl)pyrimidin-4-amine |
| SMILES | Cc1cnc(CCc2ccccc2)nc1N |
| InChI | InChI=1S/C13H15N3/c1-10-9-15-12(16-13(10)14)8-7-11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,14,15,16) |
| InChIKey | UPDQQFJPYPHXOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |