About 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine
2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine (PubChem CID 11608273) has the molecular formula C10H12N2S2
and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine |
| PubChem CID | 11608273 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine |
| SMILES | C1=CNC(SSC2C=CC=CN2)C=C1 |
| InChI | InChI=1S/C10H12N2S2/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10/h1-12H |
| InChIKey | QPTOIPBIFANHBI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine?
The IUPAC name of 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine (CID 11608273) is 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine?
The canonical SMILES for 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine is C1=CNC(SSC2C=CC=CN2)C=C1.
What is the InChIKey of 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine?
The InChIKey is QPTOIPBIFANHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S2/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10/h1-12H.
What are the key properties of 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine?
2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine has a molecular weight of 224.35 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydropyridin-2-yldisulfanyl)-1,2-dihydropyridine is sourced from PubChem (CID 11608273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).