C15H22O2 — CID 11608347
(2R,3R,4aR,5S,8aS)-2-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one (PubChem CID 11608347) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R,3R,4aR,5S,8aS)-2-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one.
| Compound Name | (2R,3R,4aR,5S,8aS)-2-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 11608347 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R,3R,4aR,5S,8aS)-2-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one |
| SMILES | C=C(C)[C@H]1C[C@@]2(C)[C@H](C=CC[C@@H]2C)C(=O)[C@@H]1O |
| InChI | InChI=1S/C15H22O2/c1-9(2)11-8-15(4)10(3)6-5-7-12(15)14(17)13(11)16/h5,7,10-13,16H,1,6,8H2,2-4H3/t10-,11+,12+,13+,15+/m0/s1 |
| InChIKey | UALVHXGADCCBEW-KMCWBVRRSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|