C14H20O3 — CID 11608364
(3aS,5aR,7R,9aS,9bR)-7-hydroxy-7,9b-dimethyl-3a,5a,6,8,9,9a-hexahydro-3H-benzo[g][2]benzofuran-1-one (PubChem CID 11608364) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3aS,5aR,7R,9aS,9bR)-7-hydroxy-7,9b-dimethyl-3a,5a,6,8,9,9a-hexahydro-3H-benzo[g][2]benzofuran-1-one.
| Compound Name | (3aS,5aR,7R,9aS,9bR)-7-hydroxy-7,9b-dimethyl-3a,5a,6,8,9,9a-hexahydro-3H-benzo[g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 11608364 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3aS,5aR,7R,9aS,9bR)-7-hydroxy-7,9b-dimethyl-3a,5a,6,8,9,9a-hexahydro-3H-benzo[g][2]benzofuran-1-one |
| SMILES | C[C@@]1(O)CC[C@H]2[C@@H](C=C[C@@H]3COC(=O)[C@@]32C)C1 |
| InChI | InChI=1S/C14H20O3/c1-13(16)6-5-11-9(7-13)3-4-10-8-17-12(15)14(10,11)2/h3-4,9-11,16H,5-8H2,1-2H3/t9-,10+,11-,13+,14-/m0/s1 |
| InChIKey | JCMJPNFASWCMBZ-CDCRFNPESA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|