C14H20N2S — CID 11608487
4-(1,2,3,4,5,6,7,8-octahydronaphthalen-2-ylmethyl)-1,3-dihydroimidazole-2-thione (PubChem CID 11608487) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-(1,2,3,4,5,6,7,8-octahydronaphthalen-2-ylmethyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(1,2,3,4,5,6,7,8-octahydronaphthalen-2-ylmethyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 11608487 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-(1,2,3,4,5,6,7,8-octahydronaphthalen-2-ylmethyl)-1,3-dihydroimidazole-2-thione |
| SMILES | S=c1[nH]cc(CC2CCC3=C(CCCC3)C2)[nH]1 |
| InChI | InChI=1S/C14H20N2S/c17-14-15-9-13(16-14)8-10-5-6-11-3-1-2-4-12(11)7-10/h9-10H,1-8H2,(H2,15,16,17) |
| InChIKey | AQMJXHWNIFYTBG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|