About CID 11608600
CID 11608600 (PubChem CID 11608600) has the molecular formula C8H11O2
and a molecular weight of 139.17 g/mol.
Molecular Properties
| Compound Name | CID 11608600 |
| PubChem CID | 11608600 |
| Molecular Formula | C8H11O2 |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | — |
| SMILES | C[C@](O)(CO)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C8H11O2/c1-8(10,6-9)7-4-2-3-5-7/h2-5,9-10H,6H2,1H3/t8-/m0/s1 |
| InChIKey | VKGRCDOFVLAHEE-QMMMGPOBSA-N |
| XLogP | 0.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11608600 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11608600?
The IUPAC name of CID 11608600 (CID 11608600) is not available.
What is the SMILES notation for CID 11608600?
The canonical SMILES for CID 11608600 is C[C@](O)(CO)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 11608600?
The InChIKey is VKGRCDOFVLAHEE-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H11O2/c1-8(10,6-9)7-4-2-3-5-7/h2-5,9-10H,6H2,1H3/t8-/m0/s1.
What are the key properties of CID 11608600?
CID 11608600 has a molecular weight of 139.17 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11608600 is sourced from PubChem (CID 11608600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).