C12H8N2O4S — CID 11608807
7-methyl-1,1-dioxo-4H-pyrido[2,3-g][1,4]benzothiazine-5,10-dione (PubChem CID 11608807) has the molecular formula C12H8N2O4S and a molecular weight of 276.27 g/mol. Its IUPAC name is 7-methyl-1,1-dioxo-4H-pyrido[2,3-g][1,4]benzothiazine-5,10-dione.
| Compound Name | 7-methyl-1,1-dioxo-4H-pyrido[2,3-g][1,4]benzothiazine-5,10-dione |
|---|---|
| PubChem CID | 11608807 |
| Molecular Formula | C12H8N2O4S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 7-methyl-1,1-dioxo-4H-pyrido[2,3-g][1,4]benzothiazine-5,10-dione |
| SMILES | Cc1ccc2c(n1)C(=O)C1=C(C2=O)S(=O)(=O)C=CN1 |
| InChI | InChI=1S/C12H8N2O4S/c1-6-2-3-7-8(14-6)11(16)9-12(10(7)15)19(17,18)5-4-13-9/h2-5,13H,1H3 |
| InChIKey | ZCRIPMBMRAPAQN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|