C17H15N3O — CID 11608830
7-methoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 11608830) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 7-methoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
| Compound Name | 7-methoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 11608830 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 7-methoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | COc1ccc2c(c1)-c1[nH]nc(Nc3ccccc3)c1C2 |
| InChI | InChI=1S/C17H15N3O/c1-21-13-8-7-11-9-15-16(14(11)10-13)19-20-17(15)18-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H2,18,19,20) |
| InChIKey | NUQUNCWBUDTVNX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |