About 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid
3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 11609205) has the molecular formula C14H14N2O6
and a molecular weight of 306.27 g/mol. Its IUPAC name is 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid |
| PubChem CID | 11609205 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1Cn1c(=O)ccn(C2CCCO2)c1=O |
| InChI | InChI=1S/C14H14N2O6/c17-10-3-5-15(11-2-1-6-21-11)14(20)16(10)8-9-4-7-22-12(9)13(18)19/h3-5,7,11H,1-2,6,8H2,(H,18,19) |
| InChIKey | RRRBKRYYKJVRPF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid?
The IUPAC name of 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid (CID 11609205) is 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid.
What is the SMILES notation for 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid?
The canonical SMILES for 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid is O=C(O)c1occc1Cn1c(=O)ccn(C2CCCO2)c1=O.
What is the InChIKey of 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid?
The InChIKey is RRRBKRYYKJVRPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O6/c17-10-3-5-15(11-2-1-6-21-11)14(20)16(10)8-9-4-7-22-12(9)13(18)19/h3-5,7,11H,1-2,6,8H2,(H,18,19).
What are the key properties of 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid?
3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid has a molecular weight of 306.27 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]furan-2-carboxylic acid is sourced from PubChem (CID 11609205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).