About 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide
3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 11609265) has the molecular formula C18H19N3S
and a molecular weight of 309.44 g/mol. Its IUPAC name is 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide.
Molecular Properties
| Compound Name | 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| PubChem CID | 11609265 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(C2=NN(C(N)=S)C(c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C18H19N3S/c1-12-3-7-14(8-4-12)16-11-17(21(20-16)18(19)22)15-9-5-13(2)6-10-15/h3-10,17H,11H2,1-2H3,(H2,19,22) |
| InChIKey | IXWUIEQWLIZCLY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide?
The IUPAC name of 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide (CID 11609265) is 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide.
What is the SMILES notation for 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide?
The canonical SMILES for 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide is Cc1ccc(C2=NN(C(N)=S)C(c3ccc(C)cc3)C2)cc1.
What is the InChIKey of 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide?
The InChIKey is IXWUIEQWLIZCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3S/c1-12-3-7-14(8-4-12)16-11-17(21(20-16)18(19)22)15-9-5-13(2)6-10-15/h3-10,17H,11H2,1-2H3,(H2,19,22).
What are the key properties of 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide?
3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide has a molecular weight of 309.44 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-methylphenyl)-3,4-dihydropyrazole-2-carbothioamide is sourced from PubChem (CID 11609265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).