About 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide
4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 11609277) has the molecular formula C12H10N2O2S3
and a molecular weight of 310.43 g/mol. Its IUPAC name is 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
| PubChem CID | 11609277 |
| Molecular Formula | C12H10N2O2S3 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc2nc(-c3csc(S(N)(=O)=O)c3)sc2c1 |
| InChI | InChI=1S/C12H10N2O2S3/c1-7-2-3-9-10(4-7)18-12(14-9)8-5-11(17-6-8)19(13,15)16/h2-6H,1H3,(H2,13,15,16) |
| InChIKey | SOGLIJJXPISIRD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide?
The IUPAC name of 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide (CID 11609277) is 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide?
The canonical SMILES for 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide is Cc1ccc2nc(-c3csc(S(N)(=O)=O)c3)sc2c1.
What is the InChIKey of 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide?
The InChIKey is SOGLIJJXPISIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2S3/c1-7-2-3-9-10(4-7)18-12(14-9)8-5-11(17-6-8)19(13,15)16/h2-6H,1H3,(H2,13,15,16).
What are the key properties of 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide?
4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide has a molecular weight of 310.43 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 11609277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).