About N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine
N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine (PubChem CID 11609318) has the molecular formula C18H40N4
and a molecular weight of 312.55 g/mol. Its IUPAC name is N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine |
| PubChem CID | 11609318 |
| Molecular Formula | C18H40N4 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.33 |
| IUPAC Name | N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine |
| SMILES | CCNCCCCNCC1CCC1CNCCCCNCC |
| InChI | InChI=1S/C18H40N4/c1-3-19-11-5-7-13-21-15-17-9-10-18(17)16-22-14-8-6-12-20-4-2/h17-22H,3-16H2,1-2H3 |
| InChIKey | YKLZLOYSULJBBB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine?
The IUPAC name of N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine (CID 11609318) is N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine.
What is the SMILES notation for N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine?
The canonical SMILES for N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine is CCNCCCCNCC1CCC1CNCCCCNCC.
What is the InChIKey of N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine?
The InChIKey is YKLZLOYSULJBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N4/c1-3-19-11-5-7-13-21-15-17-9-10-18(17)16-22-14-8-6-12-20-4-2/h17-22H,3-16H2,1-2H3.
What are the key properties of N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine?
N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine has a molecular weight of 312.55 g/mol, XLogP of 1.97, 16 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[[2-[[4-(ethylamino)butylamino]methyl]cyclobutyl]methyl]butane-1,4-diamine is sourced from PubChem (CID 11609318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).