About 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide
2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide (PubChem CID 11609502) has the molecular formula C17H12N2O5
and a molecular weight of 324.29 g/mol. Its IUPAC name is 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide.
Molecular Properties
| Compound Name | 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide |
| PubChem CID | 11609502 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O |
| InChI | InChI=1S/C17H12N2O5/c1-24-13-5-3-2-4-11(13)16(22)18-9-6-7-10-12(8-9)14(20)17(23)19-15(10)21/h2-8H,1H3,(H,18,22)(H,19,21,23) |
| InChIKey | CETPVHGKBOTXDY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
The IUPAC name of 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide (CID 11609502) is 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide.
What is the SMILES notation for 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
The canonical SMILES for 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide is COc1ccccc1C(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O.
What is the InChIKey of 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
The InChIKey is CETPVHGKBOTXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O5/c1-24-13-5-3-2-4-11(13)16(22)18-9-6-7-10-12(8-9)14(20)17(23)19-15(10)21/h2-8H,1H3,(H,18,22)(H,19,21,23).
What are the key properties of 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide?
2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide has a molecular weight of 324.29 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-(1,3,4-trioxoisoquinolin-6-yl)benzamide is sourced from PubChem (CID 11609502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).