About 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde
5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde (PubChem CID 11609648) has the molecular formula C10H8Br2N2O
and a molecular weight of 332.00 g/mol. Its IUPAC name is 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde |
| PubChem CID | 11609648 |
| Molecular Formula | C10H8Br2N2O |
| Molecular Weight | 332.00 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1ccc(Cc2cc(Br)c(Br)[nH]2)[nH]1 |
| InChI | InChI=1S/C10H8Br2N2O/c11-9-4-8(14-10(9)12)3-6-1-2-7(5-15)13-6/h1-2,4-5,13-14H,3H2 |
| InChIKey | KZZLEMQTOXPPIV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde?
The IUPAC name of 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde (CID 11609648) is 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde.
What is the SMILES notation for 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde?
The canonical SMILES for 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde is O=Cc1ccc(Cc2cc(Br)c(Br)[nH]2)[nH]1.
What is the InChIKey of 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde?
The InChIKey is KZZLEMQTOXPPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Br2N2O/c11-9-4-8(14-10(9)12)3-6-1-2-7(5-15)13-6/h1-2,4-5,13-14H,3H2.
What are the key properties of 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde?
5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde has a molecular weight of 332.00 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,5-dibromo-1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde is sourced from PubChem (CID 11609648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).