C22H20O3 — CID 11609652
(3S,7S)-5-oxapentacyclo[9.8.2.214,17.02,10.03,7]tricosa-1,10,14,16,20,22-hexaene-4,6-dione (PubChem CID 11609652) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3S,7S)-5-oxapentacyclo[9.8.2.214,17.02,10.03,7]tricosa-1,10,14,16,20,22-hexaene-4,6-dione.
| Compound Name | (3S,7S)-5-oxapentacyclo[9.8.2.214,17.02,10.03,7]tricosa-1,10,14,16,20,22-hexaene-4,6-dione |
|---|---|
| PubChem CID | 11609652 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3S,7S)-5-oxapentacyclo[9.8.2.214,17.02,10.03,7]tricosa-1,10,14,16,20,22-hexaene-4,6-dione |
| SMILES | O=C1OC(=O)[C@@H]2c3c4ccc(c3CC[C@H]12)CCc1ccc(cc1)CC4 |
| InChI | InChI=1S/C22H20O3/c23-21-18-12-11-17-15-7-5-13-1-3-14(4-2-13)6-8-16(10-9-15)19(17)20(18)22(24)25-21/h1-4,9-10,18,20H,5-8,11-12H2/t18-,20-/m0/s1 |
| InChIKey | MVIFJTWLWJPHSJ-ICSRJNTNSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|