C21H25NO4 — CID 11610075
5-(9-tert-butyl-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinolin-5-yl)benzene-1,3-diol (PubChem CID 11610075) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 5-(9-tert-butyl-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinolin-5-yl)benzene-1,3-diol.
| Compound Name | 5-(9-tert-butyl-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinolin-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 11610075 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 5-(9-tert-butyl-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinolin-5-yl)benzene-1,3-diol |
| SMILES | CC(C)(C)c1ccc2c(c1)C1OCCOC1C(c1cc(O)cc(O)c1)N2 |
| InChI | InChI=1S/C21H25NO4/c1-21(2,3)13-4-5-17-16(10-13)19-20(26-7-6-25-19)18(22-17)12-8-14(23)11-15(24)9-12/h4-5,8-11,18-20,22-24H,6-7H2,1-3H3 |
| InChIKey | IUBNARDSRYASTG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |