C20H27NO3S — CID 11610210
N-(2,6-diethylphenyl)-4-hydroxy-3-methyl-N-propylbenzenesulfonamide (PubChem CID 11610210) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-4-hydroxy-3-methyl-N-propylbenzenesulfonamide.
| Compound Name | N-(2,6-diethylphenyl)-4-hydroxy-3-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 11610210 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(2,6-diethylphenyl)-4-hydroxy-3-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCN(c1c(CC)cccc1CC)S(=O)(=O)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C20H27NO3S/c1-5-13-21(20-16(6-2)9-8-10-17(20)7-3)25(23,24)18-11-12-19(22)15(4)14-18/h8-12,14,22H,5-7,13H2,1-4H3 |
| InChIKey | OQSPUFMFVJYHSB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |