C17H18N2O5S — CID 11610219
tert-butyl 7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate (PubChem CID 11610219) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is tert-butyl 7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
| Compound Name | tert-butyl 7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
|---|---|
| PubChem CID | 11610219 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | tert-butyl 7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOc2cc(/C=C3\SC(=O)NC3=O)ccc21 |
| InChI | InChI=1S/C17H18N2O5S/c1-17(2,3)24-16(22)19-6-7-23-12-8-10(4-5-11(12)19)9-13-14(20)18-15(21)25-13/h4-5,8-9H,6-7H2,1-3H3,(H,18,20,21)/b13-9- |
| InChIKey | VAGAWBUHERSEHW-LCYFTJDESA-N |
| XLogP | 3.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|