C20H16N2O4S — CID 11610605
3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-phenylthieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 11610605) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-phenylthieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-phenylthieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11610605 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-phenylthieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)n(O)c(=O)c3scc(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C20H16N2O4S/c1-26-15-9-7-13(8-10-15)11-21-17-16(14-5-3-2-4-6-14)12-27-18(17)19(23)22(25)20(21)24/h2-10,12,25H,11H2,1H3 |
| InChIKey | VHUHCNPULYLRDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|