C21H30F3N3O — CID 11610971
N,N-dimethyl-3-[1-(1-methylimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]pentoxy]propan-1-amine (PubChem CID 11610971) has the molecular formula C21H30F3N3O and a molecular weight of 397.49 g/mol. Its IUPAC name is N,N-dimethyl-3-[1-(1-methylimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]pentoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[1-(1-methylimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]pentoxy]propan-1-amine |
|---|---|
| PubChem CID | 11610971 |
| Molecular Formula | C21H30F3N3O |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N,N-dimethyl-3-[1-(1-methylimidazol-2-yl)-1-[3-(trifluoromethyl)phenyl]pentoxy]propan-1-amine |
| SMILES | CCCCC(OCCCN(C)C)(c1cccc(C(F)(F)F)c1)c1nccn1C |
| InChI | InChI=1S/C21H30F3N3O/c1-5-6-11-20(19-25-12-14-27(19)4,28-15-8-13-26(2)3)17-9-7-10-18(16-17)21(22,23)24/h7,9-10,12,14,16H,5-6,8,11,13,15H2,1-4H3 |
| InChIKey | NSLDMDYZZZQFQK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|