C12H8Cl3F6NO — CID 11611082
[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] 2,2,2-trichloroethanimidate (PubChem CID 11611082) has the molecular formula C12H8Cl3F6NO and a molecular weight of 402.55 g/mol. Its IUPAC name is [(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11611082 |
| Molecular Formula | C12H8Cl3F6NO |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | [(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H8Cl3F6NO/c1-5(23-9(22)10(13,14)15)6-2-7(11(16,17)18)4-8(3-6)12(19,20)21/h2-5,22H,1H3/b22-9+/t5-/m0/s1 |
| InChIKey | YKVNGQNBVLFIRR-SBBMIXKFSA-N |
| XLogP | 6.15 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|