About phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate
phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate (PubChem CID 11611116) has the molecular formula C21H20N6O3
and a molecular weight of 404.43 g/mol. Its IUPAC name is phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate |
| PubChem CID | 11611116 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate |
| SMILES | CN1CC(=O)N(C)c2cnc(Nc3ccc(NC(=O)Oc4ccccc4)cc3)nc21 |
| InChI | InChI=1S/C21H20N6O3/c1-26-13-18(28)27(2)17-12-22-20(25-19(17)26)23-14-8-10-15(11-9-14)24-21(29)30-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,24,29)(H,22,23,25) |
| InChIKey | LBNZEJWYQNNQPI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate?
The IUPAC name of phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate (CID 11611116) is phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate.
What is the SMILES notation for phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate?
The canonical SMILES for phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate is CN1CC(=O)N(C)c2cnc(Nc3ccc(NC(=O)Oc4ccccc4)cc3)nc21.
What is the InChIKey of phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate?
The InChIKey is LBNZEJWYQNNQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O3/c1-26-13-18(28)27(2)17-12-22-20(25-19(17)26)23-14-8-10-15(11-9-14)24-21(29)30-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,24,29)(H,22,23,25).
What are the key properties of phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate?
phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate has a molecular weight of 404.43 g/mol, XLogP of 3.24, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[4-[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]phenyl]carbamate is sourced from PubChem (CID 11611116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).