C28H19N4- — CID 11611279
[2-cyano-2-[4-[[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-(2,4,6-trimethylphenyl)methyl]phenyl]ethenylidene]azanide (PubChem CID 11611279) has the molecular formula C28H19N4- and a molecular weight of 411.49 g/mol. Its IUPAC name is [2-cyano-2-[4-[[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-(2,4,6-trimethylphenyl)methyl]phenyl]ethenylidene]azanide.
| Compound Name | [2-cyano-2-[4-[[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-(2,4,6-trimethylphenyl)methyl]phenyl]ethenylidene]azanide |
|---|---|
| PubChem CID | 11611279 |
| Molecular Formula | C28H19N4- |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [2-cyano-2-[4-[[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-(2,4,6-trimethylphenyl)methyl]phenyl]ethenylidene]azanide |
| SMILES | Cc1cc(C)c(C(c2ccc(C(=C=[N-])C#N)cc2)=c2ccc(=C(C#N)C#N)cc2)c(C)c1 |
| InChI | InChI=1S/C28H19N4/c1-18-12-19(2)27(20(3)13-18)28(23-8-4-21(5-9-23)25(14-29)15-30)24-10-6-22(7-11-24)26(16-31)17-32/h4-13H,1-3H3/q-1 |
| InChIKey | KPHAZJTXOWKSBO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|