C20H23N5O3S — CID 11611337
formic acid;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-(1,3-thiazol-2-yl)-1H-indazole-3-carboxamide (PubChem CID 11611337) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is formic acid;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-(1,3-thiazol-2-yl)-1H-indazole-3-carboxamide.
| Compound Name | formic acid;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-(1,3-thiazol-2-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 11611337 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | formic acid;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-5-(1,3-thiazol-2-yl)-1H-indazole-3-carboxamide |
| SMILES | CN1C2CCC1CC(NC(=O)c1n[nH]c3ccc(-c4nccs4)cc13)C2.O=CO |
| InChI | InChI=1S/C19H21N5OS.CH2O2/c1-24-13-3-4-14(24)10-12(9-13)21-18(25)17-15-8-11(19-20-6-7-26-19)2-5-16(15)22-23-17;2-1-3/h2,5-8,12-14H,3-4,9-10H2,1H3,(H,21,25)(H,22,23);1H,(H,2,3) |
| InChIKey | SSIYMBLOLWSEPI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|