C26H26ClNO3 — CID 11611832
3-[1-(4-chlorophenyl)ethenyl]-N-naphthalen-1-yl-1,2,5-trioxaspiro[5.5]undecan-9-amine (PubChem CID 11611832) has the molecular formula C26H26ClNO3 and a molecular weight of 435.95 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)ethenyl]-N-naphthalen-1-yl-1,2,5-trioxaspiro[5.5]undecan-9-amine.
| Compound Name | 3-[1-(4-chlorophenyl)ethenyl]-N-naphthalen-1-yl-1,2,5-trioxaspiro[5.5]undecan-9-amine |
|---|---|
| PubChem CID | 11611832 |
| Molecular Formula | C26H26ClNO3 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[1-(4-chlorophenyl)ethenyl]-N-naphthalen-1-yl-1,2,5-trioxaspiro[5.5]undecan-9-amine |
| SMILES | C=C(c1ccc(Cl)cc1)C1COC2(CCC(Nc3cccc4ccccc34)CC2)OO1 |
| InChI | InChI=1S/C26H26ClNO3/c1-18(19-9-11-21(27)12-10-19)25-17-29-26(31-30-25)15-13-22(14-16-26)28-24-8-4-6-20-5-2-3-7-23(20)24/h2-12,22,25,28H,1,13-17H2 |
| InChIKey | DAPVMFKOBJPYGI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|