About 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid
4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid (PubChem CID 11611966) has the molecular formula C17H20ClN7O3
and a molecular weight of 405.85 g/mol. Its IUPAC name is 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid |
| PubChem CID | 11611966 |
| Molecular Formula | C17H20ClN7O3 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid |
| SMILES | N/C(=N\CCCCc1ccc(C(=O)O)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C17H20ClN7O3/c18-12-14(20)24-13(19)11(23-12)15(26)25-17(21)22-8-2-1-3-9-4-6-10(7-5-9)16(27)28/h4-7H,1-3,8H2,(H,27,28)(H4,19,20,24)(H3,21,22,25,26) |
| InChIKey | KQSVMIMWOAPSFB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid?
The IUPAC name of 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid (CID 11611966) is 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid.
What is the SMILES notation for 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid?
The canonical SMILES for 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid is N/C(=N\CCCCc1ccc(C(=O)O)cc1)NC(=O)c1nc(Cl)c(N)nc1N.
What is the InChIKey of 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid?
The InChIKey is KQSVMIMWOAPSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN7O3/c18-12-14(20)24-13(19)11(23-12)15(26)25-17(21)22-8-2-1-3-9-4-6-10(7-5-9)16(27)28/h4-7H,1-3,8H2,(H,27,28)(H4,19,20,24)(H3,21,22,25,26).
What are the key properties of 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid?
4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid has a molecular weight of 405.85 g/mol, XLogP of 1.06, 7 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoic acid is sourced from PubChem (CID 11611966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).