About 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 11612136) has the molecular formula C21H21Cl2FN4O2
and a molecular weight of 451.33 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine |
| PubChem CID | 11612136 |
| Molecular Formula | C21H21Cl2FN4O2 |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(C3CCOCC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H21Cl2FN4O2/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-26-21(18)25)14-10-27-28(11-14)15-4-6-29-7-5-15/h2-3,8-12,15H,4-7H2,1H3,(H2,25,26) |
| InChIKey | VRFBKBFDZDKNBO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine?
The IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine (CID 11612136) is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine.
What is the SMILES notation for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine?
The canonical SMILES for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine is CC(Oc1cc(-c2cnn(C3CCOCC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine?
The InChIKey is VRFBKBFDZDKNBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2FN4O2/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-26-21(18)25)14-10-27-28(11-14)15-4-6-29-7-5-15/h2-3,8-12,15H,4-7H2,1H3,(H2,25,26).
What are the key properties of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine?
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine has a molecular weight of 451.33 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(oxan-4-yl)pyrazol-4-yl]pyridin-2-amine is sourced from PubChem (CID 11612136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).