C25H48O3Si2 — CID 11612172
tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]hex-3-en-5-ynoxy]silane (PubChem CID 11612172) has the molecular formula C25H48O3Si2 and a molecular weight of 452.83 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]hex-3-en-5-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]hex-3-en-5-ynoxy]silane |
|---|---|
| PubChem CID | 11612172 |
| Molecular Formula | C25H48O3Si2 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]hex-3-en-5-ynoxy]silane |
| SMILES | C#C/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](/C=C/C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C25H48O3Si2/c1-13-15-16-18-23(28-30(11,12)24(3,4)5)25(6,7)22(17-14-2)27-21-26-19-20-29(8,9)10/h1,14-17,22-23H,18-21H2,2-12H3/b16-15-,17-14+/t22-,23-/m0/s1 |
| InChIKey | JVBFHWZMHDUSGB-QMRLPARKSA-N |
| XLogP | 7.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|